Organophosphorus compounds
ILEX LIFE SCIENCES LLC GELACELL PCLPLGA CELLCROWN 12W
Gelacell - PCL:PLGA scaffolds fixed to cell crowns in 12-well plate for 3D cell culture (1 plate). INTRO: Gelacell, manufactured by Gelatex Technologies, is a unique, 3D microfibrous scaffold specifically engineered for advanced in vitro 3D cell culture and tissue engineering applications. DESCRIPTION: This variant of Gelacell is specially designed for medium-to-long term cell culture durations. Scaffolds made from pharmaceutical grade polycaprolactone + poly lactic-co-glycolic acid (PCL:PLGA ratio is 70:30) are fixed to cell crowns in a 12-well plate. The cell crowns act as Boyden chambers for facilitating studies related to air-liquid interface culture, co-culture, complex tissue models, etc. The optimized design ensures thermal, chemical, and mechanical stability, while also providing substantial swelling capabilities and porosity, allowing efficient nutrient diffusion and thereby preventing cellular waste build up.
Accela Chembio Inc MF: C24H31P | MW: 350.48 | >97% | Flash Point: 271.7 celsius.
MF: C24H31P | MW: 350.48 | >97% | Flash Point: 271.7 celsius.
eMolecules Methyldiphenylphosphine | Ambeed | 1486-28-8 | MFCD00008508 | 200.221 | C13H13P | 98.000 | CP(c1ccccc1)c1ccccc1 | 5g | 552760080
Methyldiphenylphosphine | Ambeed | 1486-28-8 | MFCD00008508 | 200.221 | C13H13P | 98.000 | CP(c1ccccc1)c1ccccc1 | 5g | 552760080
eMolecules Cyclopropyl-thiophen-2-ylmethyl-amine | 14471-18-2 | MFCD03856576 | 1g
Combi-Blocks | Cyclopropyl-thiophen-2-ylmethyl-amine | 1g | 117567847 | ST-0878 | 98.000 | 14471-18-2 | MFCD03856576 | 153.240 | C8H11NS
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
eMolecules 2-(Di-t-butylphosphino))-1,1'-biphenyl, 99% JohnPhos | Strem Chemicals | 224311-51-7 | MFCD01862440 | 298.410 | C20H27P | 99.000 | CC(C)(C)P(c1ccccc1-c1ccccc1)C(C)(C)C | 2g | 321336050
2-(Di-t-butylphosphino))-1,1'-biphenyl, 99% JohnPhos | Strem Chemicals | 224311-51-7 | MFCD01862440 | 298.410 | C20H27P | 99.000 | CC(C)(C)P(c1ccccc1-c1ccccc1)C(C)(C)C | 2g | 321336050
eMolecules ChemScene Xphos Pd G4 100mg 536798520 CS-0080595 0 000 1599466-81-5 MFCD28411652 860 490 C47H64NO3PPdS
ChemScene Xphos Pd G4 100mg 536798520 CS-0080595 0 000 1599466-81-5 MFCD28411652 860 490 C47H64NO3PPdS